BD9233331
L-Arginine L-aspartate , 97% , 7675-83-4
Synonym(s):
L -Arginine L -aspartate salt;S(+)-2-Amino-5-[(aminoiminomethyl)amino]pentanoic acid monohydrochloride
CAS NO.：7675-83-4
Empirical Formula: C10H21N5O6
Molecular Weight: 307.3
MDL number: MFCD00058334
EINECS: 231-656-8
| Pack Size | Price | Stock | Quantity |
| 25g | RMB59.20 | In Stock |
|
| 100g | RMB144.00 | In Stock |
|
| 500g | RMB340.80 | In Stock |
|
| 1000g | RMB658.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-221 °C |
| storage temp. | 2-8°C |
| solubility | Very soluble in water, practically insoluble in alcohol and in methylene chloride. |
| form | solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | HAIR CONDITIONING SKIN CONDITIONING |
| InChI | InChI=1S/C6H14N4O2.C4H7NO4/c7-4(5(11)12)2-1-3-10-6(8)9;5-2(4(8)9)1-3(6)7/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2H,1,5H2,(H,6,7)(H,8,9)/t4-;2-/m00/s1 |
| InChIKey | SUUWYOYAXFUOLX-ZBRNBAAYSA-N |
| SMILES | C([C@H](N)C(=O)O)CCNC(N)=N.[C@@H](N)(C(=O)O)CC(=O)O |
| LogP | -1.287 (est) |
| CAS DataBase Reference | 7675-83-4(CAS DataBase Reference) |
| EPA Substance Registry System | Arginine aspartate (7675-83-4) |
Description and Uses
Amino acid; nutrient.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
