BD9247531
Ethyl 2-(oxetan-3-ylidene)acetate , 97% , 922500-91-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB45.60 | In Stock |
|
| 250mg | RMB76.80 | In Stock |
|
| 1g | RMB163.20 | In Stock |
|
| 5g | RMB493.60 | In Stock |
|
| 25g | RMB1562.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 207℃ |
| Density | 1.228 |
| Flash point: | 78℃ |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| form | liquid |
| color | Colourless to light yellow |
| InChI | InChI=1S/C7H10O3/c1-2-10-7(8)3-6-4-9-5-6/h3H,2,4-5H2,1H3 |
| InChIKey | CVZGHWOZWYWLBL-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)/C=C1\COC\1 |
Description and Uses
Ethyl 2-(Oxetan-3-ylidene)acetate is a CBL-?B inhibitors which is used in the treatment of cancer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HS Code | 29329990 |
