BD9258531
4-Bromo-2,6-diisopropylaniline , 98% , 80058-84-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.80 | In Stock |
|
| 5g | RMB144.00 | In Stock |
|
| 10g | RMB274.40 | In Stock |
|
| 25g | RMB631.20 | In Stock |
|
| 100g | RMB2350.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 110 °C(Press: 0.14 Torr) |
| Density | 1.231±0.06 g/cm3(Predicted) |
| refractive index | 1.57 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 3.54±0.10(Predicted) |
| color | Yellow to Brown |
| InChI | InChI=1S/C12H18BrN/c1-7(2)10-5-9(13)6-11(8(3)4)12(10)14/h5-8H,14H2,1-4H3 |
| InChIKey | QAQRHTYPYQPBSX-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C(C)C)C=C(Br)C=C1C(C)C |
Description and Uses
4-Bromo-2,6-diisopropylaniline is used as a reactant in the preparation of hyperbranched ethylene oligomers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| HS Code | 2921.49.5000 |
