BD9266731
Ethyl 2-chloro-2-(2-(4-methoxyphenyl)hydrazono)acetate , 97% , 27143-07-3
CAS NO.:27143-07-3
Empirical Formula: C11H13ClN2O3
Molecular Weight: 256.69
MDL number: MFCD02852962
EINECS: 608-053-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB52.80 | In Stock |
|
| 5g | RMB189.60 | In Stock |
|
| 10g | RMB316.80 | In Stock |
|
| 25g | RMB506.40 | In Stock |
|
| 100g | RMB1317.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94℃ |
| Boiling point: | 349.0±44.0 °C(Predicted) |
| Density | 1.23 |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 11.63±0.10(Predicted) |
| color | Yellow to Dark Yellow |
| InChI | InChI=1S/C11H13ClN2O3/c1-3-17-11(15)10(12)14-13-8-4-6-9(16-2)7-5-8/h4-7,13H,3H2,1-2H3 |
| InChIKey | ATNPZEGMKLGIFA-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Cl)=NNC1=CC=C(OC)C=C1 |
Description and Uses
Acetic acid, 2-chloro-2-[2-(4-methoxyphenyl)hydrazinylidene], ethyl ester is an ester derivative and can be used as an intermediate in the synthesis of apixaban.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362 |







