BD9299731
7-Chloro-4-(piperazin-1-yl)quinoline , 95% , 837-52-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB28.80 | In Stock |
|
| 1g | RMB83.20 | In Stock |
|
| 5g | RMB335.20 | In Stock |
|
| 10g | RMB571.20 | In Stock |
|
| 25g | RMB1388.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-116 |
| Boiling point: | 433.5±35.0 °C(Predicted) |
| Density | 1.257±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Very Slightly) |
| form | Solid |
| pka | 8.62±0.50(Predicted) |
| color | Light Yellow to Yellow |
| InChI | InChI=1S/C13H14ClN3/c14-10-1-2-11-12(9-10)16-4-3-13(11)17-7-5-15-6-8-17/h1-4,9,15H,5-8H2 |
| InChIKey | DNXNPMDUDGUXOB-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C(Cl)C=2)C(N2CCNCC2)=CC=1 |
Description and Uses
7-Chloro-4-(piperazin-1-yl)quinoline is a metabolite of Piperaquine phosphate (P480050), a low toxicity and quick acting antimalarial drug that is used to treat malaria.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353 |
| Hazard Codes | C,Xi,Xn |
| Risk Statements | 34-22 |
| Safety Statements | 22-26-36/37/39-45 |
| WGK Germany | WGK 3 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |






