BD9323131
Fmoc-Gly-Opfp , 98%HPLC , 86060-85-7
Synonym(s):
Fmoc-Gly-OPfp;N-α-Fmoc-glycine pentafluorophenyl ester
| Pack Size | Price | Stock | Quantity |
| 1g | RMB186.40 | In Stock |
|
| 5g | RMB652.80 | In Stock |
|
| 25g | RMB2285.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-160 °C |
| Density | 1.4222 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| color | White to off-white |
| Major Application | peptide synthesis |
| InChI | 1S/C23H14F5NO4/c24-17-18(25)20(27)22(21(28)19(17)26)33-16(30)9-29-23(31)32-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15H,9-10H2,(H,29,31) |
| InChIKey | LBSDTBJWUJIFBO-UHFFFAOYSA-N |
| SMILES | Fc1c(c(c(c(c1F)F)OC(=O)CNC(=O)OCC2c3c(cccc3)c4c2cccc4)F)F |
| CAS DataBase Reference | 86060-85-7(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P332+P313-P362+P364 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Irrit. 2 |
