BD9324231
(Z)-tert-Butyl 2-(((1-(2-aminothiazol-4-yl)-2-ethoxy-2-oxoethylidene)amino)oxy)-2-methylpropanoate , 97% , 86299-46-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB58.40 | In Stock |
|
| 25g | RMB168.00 | In Stock |
|
| 100g | RMB660.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-174°C |
| Boiling point: | 462.8±51.0 °C(Predicted) |
| Density | 1.2750 (rough estimate) |
| refractive index | 1.6390 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 1.31±0.10(Predicted) |
| Water Solubility | INSOLUBLE |
| InChI | InChI=1S/C15H23N3O5S/c1-7-21-11(19)10(9-8-24-13(16)17-9)18-23-15(5,6)12(20)22-14(2,3)4/h8H,7H2,1-6H3,(H2,16,17)/b18-10- |
| InChIKey | GVGJDTAQZPCVCX-ZDLGFXPLSA-N |
| SMILES | C(/C1N=C(SC=1)N)(\C(=O)OCC)=N\OC(C)(C)C(=O)OC(C)(C)C |
| CAS DataBase Reference | 86299-46-9(CAS DataBase Reference) |
Description and Uses
Used in the manufacture of cephalosporins such as ceftazidime.
Safety
| Safety Statements | 24/25 |




