BD9330131
N-(3-Formylpyridin-2-yl)pivalamide , 95% , 86847-64-5
Synonym(s):
N-(3-Formylpyridin-2-yl)-2,2-dimethylpropanamide;N-(3-Formylpyridin-2-yl)-2,2-dimethylpropionamide
| Pack Size | Price | Stock | Quantity |
| 1g | RMB510.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-88°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| Appearance | Light yellow to yellow Solid |
| Sensitive | Air Sensitive |
| InChI | 1S/C11H14N2O2/c1-11(2,3)10(15)13-9-8(7-14)5-4-6-12-9/h4-7H,1-3H3,(H,12,13,15) |
| InChIKey | ANABHCSYKASRRW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1ncccc1C=O |
| CAS DataBase Reference | 86847-64-5(CAS DataBase Reference) |
Description and Uses
Reactant for:• ;Preparation of disubstituted azaindolines1
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
