BD9432955
Trans,trans-2,4-hexadien-1-ol , 98%(stabilizerwith0.1%alpha-tocopherol) , 17102-64-6
Synonym(s):
(E,E)-2,4-Hexadien-1-ol;Sorbic alcohol
CAS NO.:17102-64-6
Empirical Formula: C6H10O
Molecular Weight: 98.14
MDL number: MFCD00002925
EINECS: 241-173-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB126.40 | In Stock |
|
| 25g | RMB369.60 | In Stock |
|
| 100g | RMB1176.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 28-33 °C (lit.) |
| Boiling point: | 80 °C/12 mmHg (lit.) |
| Density | 0.871 g/mL at 25 °C (lit.) |
| vapor density | >1 (vs air) |
| refractive index | n |
| Flash point: | 162 °F |
| storage temp. | Storage temp. 2-8°C |
| pka | 14.27±0.10(Predicted) |
| form | Liquid After Melting |
| color | Clear colorless to light yellow |
| Odor | at 100.00 %. fresh green herbal |
| Odor Type | green |
| biological source | synthetic |
| Water Solubility | Slightly miscible with water. |
| JECFA Number | 1174 |
| BRN | 1719718 |
| Major Application | flavors and fragrances |
| InChI | 1S/C6H10O/c1-2-3-4-5-6-7/h2-5,7H,6H2,1H3/b3-2+,5-4+ |
| InChIKey | MEIRRNXMZYDVDW-MQQKCMAXSA-N |
| SMILES | [H]/C(C)=C([H])\C([H])=C(/[H])CO |
| LogP | 1.083 (est) |
| CAS DataBase Reference | 17102-64-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4-Hexadien-1-ol, (E,E)-(17102-64-6) |
| EPA Substance Registry System | 2,4-Hexadien-1-ol, (2E,4E)- (17102-64-6) |
Description and Uses
Trans,trans-2,4-Hexadien-1-ol is used in the preparation of trans-2,3-methano-4(Z)-hexenol by reacting with diiodomethane. It is used as a flavor and fragrance agent having pineapple odor.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H311-H315-H318 |
| Precautionary statements | P280-P301+P312+P330-P302+P352+P312-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 21/22-38-41-36/37/38-36/38-21 |
| Safety Statements | 26-36-39-37/39-36/37 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | MM3325000 |
| F | 8-10-23 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| HS Code | 29052990 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Eye Irrit. 2 Skin Irrit. 2 |






