BD9437431
2-(4-Boronophenyl)acetic acid , 98% , 90111-58-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB68.00 | In Stock |
|
| 250mg | RMB95.20 | In Stock |
|
| 1g | RMB330.40 | In Stock |
|
| 5g | RMB1095.20 | In Stock |
|
| 10g | RMB2112.00 | In Stock |
|
| 25g | RMB5151.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-160°C |
| Boiling point: | 416.1±47.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.23±0.10(Predicted) |
| color | White to Off-White |
| InChI | 1S/C8H9BO4/c10-8(11)5-6-1-3-7(4-2-6)9(12)13/h1-4,12-13H,5H2,(H,10,11) |
| InChIKey | NFGJQVPDPIGBJE-UHFFFAOYSA-N |
| SMILES | OB(O)C1=CC=C(CC(O)=O)C=C1 |
Description and Uses
4-Carboxymethylphenylboronic acid
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P305+P351+P338 |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |






![methyl 2-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate](https://img.chemicalbook.com/CAS/GIF/454185-98-9.gif)