BD9460631
N-(2-Chloropyrimidin-4-yl)-N,2,3-trimethyl-2H-indazol-6-amine , 97% , 444731-75-3
CAS NO.:444731-75-3
Empirical Formula: C14H14ClN5
Molecular Weight: 287.75
MDL number: MFCD12923006
EINECS: 810-050-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB39.20 | In Stock |
|
| 1g | RMB52.80 | In Stock |
|
| 5g | RMB263.20 | In Stock |
|
| 10g | RMB448.00 | In Stock |
|
| 25g | RMB896.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-173℃ |
| Boiling point: | 524.4±35.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Very Slightly) |
| pka | 2.82±0.30(Predicted) |
| Appearance | Off-white to light yellow Solid |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C14H14ClN5/c1-9-11-5-4-10(8-12(11)18-20(9)3)19(2)13-6-7-16-14(15)17-13/h4-8H,1-3H3 |
| InChIKey | DVGMRZQSSNNTFY-UHFFFAOYSA-N |
| SMILES | N1=C2C(C=CC(N(C3C=CN=C(Cl)N=3)C)=C2)=C(C)N1C |
| CAS DataBase Reference | 444731-75-3 |
Description and Uses
N-(2-Chloro-4-pyrimidinyl)-N,2,3-trimethyl-2H-indazol-6-amine is an impurity of Pazopanib (P210925), an oral angiogenesis inhibitor targeting VEGFR and PDGFR.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |







