![6-Chloro-3-(cyclopentylmethyl)-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine-7-sulfonamide1,1-dioxide](https://img.chemicalbook.com/CAS/GIF/742-20-1.gif)
BD9465355
6-Chloro-3-(cyclopentylmethyl)-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine-7-sulfonamide1,1-dioxide , 98% , 742-20-1
CAS NO.：742-20-1
Empirical Formula: C13H18ClN3O4S2
Molecular Weight: 379.88
MDL number: MFCD00865825
EINECS: 212-012-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB144.00 | In Stock |
|
| 1g | RMB360.00 | In Stock |
|
| 5g | RMB1257.60 | In Stock |
|
| 25g | RMB3772.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230° |
| Boiling point: | 605.6±65.0 °C(Predicted) |
| Density | 1.3650 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| storage temp. | Refrigerator |
| solubility | Acetonitrile (Slightly), DMSO (Slightly), Methanol (Sparingly) |
| form | Solid |
| pka | 9.00±0.40(Predicted) |
| color | White to Off-White |
| Water Solubility | 50mg/L(room temperature) |
| Major Application | pharmaceutical pharmaceutical small molecule |
| InChI | 1S/C13H18ClN3O4S2/c14-9-6-10-12(7-11(9)22(15,18)19)23(20,21)17-13(16-10)5-8-3-1-2-4-8/h6-8,13,16-17H,1-5H2,(H2,15,18,19) |
| InChIKey | BKYKPTRYDKTTJY-UHFFFAOYSA-N |
| SMILES | [S]1(=O)(=O)NC(Nc3c1cc(c(c3)Cl)[S](=O)(=O)N)CC2CCCC2 |
| CAS DataBase Reference | 742-20-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3-(cyclopentylmethyl)-3,4-dihydro-, 1,1-dioxide (742-20-1) |
Description and Uses
Antihypertensive;Sodium Chloride Symporter Inhibitor
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H373 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| WGK Germany | WGK 1 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 in rats, mice (mg/kg): 141.8 ±24, 232.4 ±25 i.v. (Barrett) |
