BD9483447
Fmoc-D-Aph(Cbm)-OH , 98% , 324017-22-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB321.60 | In Stock |
|
| 250mg | RMB513.60 | In Stock |
|
| 1g | RMB1334.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163℃ (decomposition) |
| Boiling point: | 699.1±55.0 °C(Predicted) |
| Density | 1.376±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| pka | 3.82±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChIKey | HFPDOFBZCSQAEJ-JOCHJYFZSA-N |
| SMILES | C(O)(=O)[C@@H](CC1=CC=C(NC(N)=O)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
Description and Uses
Fmoc-D-4-Aph(cBm)-OH is an amino acid derivative with an Fmoc protecting group, which can be used to synthesize biologically active peptide mimetics, such as Ac-D2Nal-D4Cpa-D3Pal-Ser-4Aph/4Amf(P)-D4Aph/D4Amf(Q)-Leu-ILys-Pro-DAla-NH2 with gonadotropin-releasing hormone (GnRH) antagonist activity[1].






