BD9502131
5-Bromo-1,3-difluoro-2-(trifluoromethoxy)benzene , 97% , 115467-07-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB40.80 | In Stock |
|
| 1g | RMB68.80 | In Stock |
|
| 5g | RMB282.40 | In Stock |
|
| 25g | RMB1249.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 175.3±35.0 °C(Predicted) |
| Density | 1.793±0.06 g/cm3(Predicted) |
| refractive index | 1.4330 to 1.4370 |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C7H2BrF5O/c8-3-1-4(9)6(5(10)2-3)14-7(11,12)13/h1-2H |
| InChIKey | ORHCJZZKAUAZDR-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(Br)=CC(F)=C1OC(F)(F)F |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| HS Code | 2909309090 |
| REACH Registrations | Inactive |






