BD9506031
4,5,6,7-Tetrabromo-3,3-bis(4-hydroxyphenyl)-3H-benzo[c][1,2]oxathiole 1,1-dioxide , 95% , 77172-72-6
CAS NO.:77172-72-6
Empirical Formula: C19H10Br4O5S
Molecular Weight: 669.96
MDL number: MFCD00009744
| Pack Size | Price | Stock | Quantity |
| 1g | RMB284.00 | In Stock |
|
| 5g | RMB1169.60 | In Stock |
|
| 10g | RMB2034.40 | In Stock |
|
| 25g | RMB4118.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270-271 °C |
| Boiling point: | 696.1±55.0 °C(Predicted) |
| Density | 2.199±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Solid |
| pka | 7.88±0.50(Predicted) |
| color | Purple to purplish red |
| λmax | 426 nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C19H10Br4O5S/c20-14-13-18(17(23)16(22)15(14)21)29(26,27)28-19(13,9-1-5-11(24)6-2-9)10-3-7-12(25)8-4-10/h1-8,24-25H |
| InChIKey | ARVZQGSXIKSAAY-UHFFFAOYSA-N |
| SMILES | S1(=O)(=O)C2=C(Br)C(Br)=C(Br)C(Br)=C2C(C2=CC=C(O)C=C2)(C2=CC=C(O)C=C2)O1 |
Description and Uses
3,4,5,6-Tetrabromophenol sulfonephthalein is a stain for cell biology.
diagnostic assay manufacturing
hematology
histology
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 38220090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![4,5,6,7-Tetrabromo-3,3-bis(4-hydroxyphenyl)-3H-benzo[c][1,2]oxathiole 1,1-dioxide](https://img.chemicalbook.com/CAS/GIF/77172-72-6.gif)




