BD9509531
(R)-4-Hydroxypyrrolidin-2-one , 95% , 22677-21-0
Synonym(s):
(R)-β-Hydroxy-γ-butyrolactam
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB37.60 | In Stock |
|
| 1g | RMB75.20 | In Stock |
|
| 5g | RMB276.80 | In Stock |
|
| 10g | RMB470.40 | In Stock |
|
| 25g | RMB943.20 | In Stock |
|
| 100g | RMB3100.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156-160 °C |
| Boiling point: | 363.6±35.0 °C(Predicted) |
| Density | 1.292±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Sparingly), Methanol (Slightly), Water (Sparingly) |
| pka | 13.62±0.20(Predicted) |
| form | Powder |
| color | White to pale yellow |
| optical activity | [α]23/D +43°, c = 1 in ethanol |
| Water Solubility | Slightly soluble in water. |
| BRN | 1524193 |
| InChI | InChI=1S/C4H7NO2/c6-3-1-4(7)5-2-3/h3,6H,1-2H2,(H,5,7)/t3-/m1/s1 |
| InChIKey | IOGISYQVOGVIEU-GSVOUGTGSA-N |
| SMILES | N1C[C@H](O)CC1=O |
| CAS DataBase Reference | 22677-21-0(CAS DataBase Reference) |
Description and Uses
The (R)-enantiomer intermediate in the preparation of Oxiracetam
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-38-37-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29339900 |






