BD9524255
2-Bromocyclohexane-1,3-dione , 97+% , 60060-44-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB57.60 | In Stock |
|
| 1g | RMB137.60 | In Stock |
|
| 5g | RMB452.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-161° |
| Boiling point: | 272.6±40.0 °C(Predicted) |
| Density | 1.678±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 3.46±0.25(Predicted) |
| color | Pale Beige Colour |
| InChI | InChI=1S/C6H7BrO2/c7-6-4(8)2-1-3-5(6)9/h6H,1-3H2 |
| InChIKey | UBUJDMSDEQBNTG-UHFFFAOYSA-N |
| SMILES | C1(=O)CCCC(=O)C1Br |
Description and Uses
2-Bromo-1,3-cyclohexanedione is an starting material in the synthesis of azole derivatives as histamine H3 receptor antagonists.
Safety
| HazardClass | IRRITANT |
| HS Code | 2914790090 |
