BD9537455
Ethyl(4-chloro-3-(trifluoromethyl)phenyl)carbamate , 97% , 18585-06-3
CAS NO.：18585-06-3
Empirical Formula: C10H9ClF3NO2
Molecular Weight: 267.63
MDL number: MFCD00043450
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB120.00 | In Stock |
|
| 250mg | RMB168.00 | In Stock |
|
| 1g | RMB401.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 252.5±40.0 °C(Predicted) |
| Density | 1.402±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 12.44±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | 1S/C10H9ClF3NO2/c1-2-17-9(16)15-6-3-4-8(11)7(5-6)10(12,13)14/h3-5H,2H2,1H3,(H,15,16) |
| InChIKey | BAFPGGUKCVCSKG-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1c(ccc(c1)NC(=O)OCC)Cl |
Description and Uses
Ethyl (4-Chloro-3-(trifluoromethyl)phenyl)carbamate is an impurity of Sorafenib (S676850); a multiple kinase inhibitor targeting both RAF and receptor tyrosine kinases that promote angiogenesis. Also antineoplastic.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
