BD9538747
1,5-Dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazole-4-carbaldehyde , 95% , 950-81-2
Synonym(s):
2,3-Dimethyl-5-oxo-1-phenyl-3-pyrazoline-4-carboxaldehyde;Antipyraldehyde
CAS NO.:950-81-2
Empirical Formula: C12H12N2O2
Molecular Weight: 216.24
MDL number: MFCD00003144
EINECS: 213-452-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB78.40 | In Stock |
|
| 1g | RMB229.60 | In Stock |
|
| 5g | RMB784.80 | In Stock |
|
| 25g | RMB2746.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-165 °C (lit.) |
| Boiling point: | 334.8±52.0 °C(Predicted) |
| Density | 1.292±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -1.39±0.60(Predicted) |
| form | crystalline powder |
| color | Off white |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | 1S/C12H12N2O2/c1-9-11(8-15)12(16)14(13(9)2)10-6-4-3-5-7-10/h3-8H,1-2H3 |
| InChIKey | QFYZFYDOEJZMDX-UHFFFAOYSA-N |
| SMILES | [H]C(=O)C1=C(C)N(C)N(c2ccccc2)C1=O |
| CAS DataBase Reference | 950-81-2(CAS DataBase Reference) |
Description and Uses
4-Antipyrinecarboxaldehyde was used in the synthesis of a new crown ether-antipyrine schiffs base.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933199090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





