BD9544231
5'-O-[Bis(4-methoxyphenyl)phenylmethyl]-adenosine , 95% , 81352-25-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB73.60 | In Stock |
|
| 1g | RMB190.40 | In Stock |
|
| 5g | RMB676.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-147 °C |
| Boiling point: | 812.0±75.0 °C(Predicted) |
| Density | 1.40±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| pka | 13.08±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| InChIKey | KOQFCLKBHJBRTB-WMPYGVGNNA-N |
| SMILES | O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C3=C(C(=NC=N3)N)N=C2)[C@H](O)[C@@H]1O |&1:25,27,38,40,r| |
Description and Uses
5''-O-[Bis(4-methoxyphenyl)phenylmethyl]-adenosine is an oligonucleotide used in the synthesis of oligonucleotides carrying fluorescently labeled O6-alkylguanine for measuring hAGT activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |

![5'-O-[Bis(4-methoxyphenyl)phenylmethyl]-adenosine](https://img.chemicalbook.com/CAS/GIF/81352-25-2.gif)




