BD9548855
Adamantane-1,3,5,7-tetracarboxylicacid , 95% , 100884-80-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB294.40 | In Stock |
|
| 250mg | RMB576.00 | In Stock |
|
| 1g | RMB2092.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 395 °C (decomp)(Solv: acetic acid (64-19-7)) |
| Boiling point: | 403.6±40.0 °C(Predicted) |
| Density | 1.864±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 3.29±0.70(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C14H16O8/c15-7(16)11-1-12(8(17)18)4-13(2-11,9(19)20)6-14(3-11,5-12)10(21)22/h1-6H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | VWAIZPYLEYEEFK-UHFFFAOYSA-N |
| SMILES | C12(C(O)=O)CC3(C(O)=O)CC(C(O)=O)(CC(C(O)=O)(C3)C1)C2 |
Description and Uses
1,3,5,7-ADAMANTANETETRACARBOXYLIC ACID is used as a ligand in the synthesis of MOF materials: MOF-77(Zn), MOF-35(Zn).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |






