BD9550231
Hesperetin 7-O-glucoside , 98+% , 31712-49-9
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB848.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 206-207 °C |
| Boiling point: | 807.1±65.0 °C(Predicted) |
| Density | 1.569±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 7.16±0.40(Predicted) |
| color | White to off-white |
| InChIKey | ADSYMQORONDIDD-QENDSQSDNA-N |
| SMILES | O=C1C[C@@H](C2C=CC(OC)=C(O)C=2)OC2=CC(O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O3)O)=CC(O)=C12 |&1:3,18,19,20,22,24,r| |
Description and Uses
Hesperetin 7-O-glucoside can be used to treat osteoporosis, scavenging free radicals, varicose veins, reducing blood lipid and decreasing blood pressure. It can also be used to promote plant growth and treat plant anti-bacterial infections.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P362+P364-P332+P313-P337+P313-P403+P233-P405-P501 |




