BD9609955
2-Butylisoindoline-1,3-dione , 98+% , 1515-72-6
Synonym(s):
2-Butyl-1H-isoindole-1,3(2H)-dione
CAS NO.:1515-72-6
Empirical Formula: C12H13NO2
Molecular Weight: 203.24
MDL number: MFCD00039695
EINECS: 216-157-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB28.00 | In Stock |
|
| 25g | RMB87.20 | In Stock |
|
| 100g | RMB274.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 29-33 °C |
| Boiling point: | 120-123°C 5mm |
| Density | 1.1255 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| Flash point: | 120-123°C/5mm |
| storage temp. | Store at room temperature |
| pka | -2.09±0.20(Predicted) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| BRN | 147784 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING PLASTICISER |
| InChI | InChI=1S/C12H13NO2/c1-2-3-8-13-11(14)9-6-4-5-7-10(9)12(13)15/h4-7H,2-3,8H2,1H3 |
| InChIKey | DLKDEVCJRCPTLN-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1CCCC |
| LogP | 3.150 (est) |
| CAS DataBase Reference | 1515-72-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Isoindole-1,3(2H)-dione, 2-butyl- (1515-72-6) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 24/25-39-26 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |






