BD9632531
(R)-4-Amino-3-hydroxybutanoic acid , 95% , 7013-07-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB122.40 | In Stock |
|
| 250mg | RMB284.80 | In Stock |
|
| 1g | RMB952.00 | In Stock |
|
| 5g | RMB4160.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 216-217 °C (decomp)(Solv: water (7732-18-5); ethanol (64-17-5)) |
| Boiling point: | 374.5±32.0 °C(Predicted) |
| Density | 1.312±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | PBS (pH 7.2): 10 mg/ml |
| form | Solid |
| pka | 4.04±0.10(Predicted) |
| color | White |
| InChI | InChI=1S/C4H9NO3/c5-2-3(6)1-4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m1/s1 |
| InChIKey | YQGDEPYYFWUPGO-GSVOUGTGSA-N |
| SMILES | C(O)(=O)C[C@@H](O)CN |
| CAS DataBase Reference | 7013-07-2(CAS DataBase Reference) |
Description and Uses
(R)-4-Amino-3-hydroxybutanoic Acid is an intermediate in the synthesis of Stearoyl-L-carnitine-13C3 Chloride (S686517) which is carbon-13 labeled R-Stearoyl Carnitine Chloride (S686515), which is a carnitine ester tested for its ability to inhibit protein kinase C (PKC).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
