BD9648131
(3R,5S)-rel-tert-Butyl 3,5-dimethylpiperazine-1-carboxylate , 98% , 129779-30-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB28.80 | In Stock |
|
| 1g | RMB79.20 | In Stock |
|
| 5g | RMB222.40 | In Stock |
|
| 10g | RMB370.40 | In Stock |
|
| 25g | RMB692.00 | In Stock |
|
| 100g | RMB2121.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-71° |
| Boiling point: | 279.7±15.0℃ (760 Torr) |
| Density | 0.970±0.06 g/cm3 (20 ºC 760 Torr) |
| Flash point: | 123.0±20.4℃ |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | solid |
| pka | 8.58±0.60(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1/C11H22N2O2/c1-8-6-13(7-9(2)12-8)10(14)15-11(3,4)5/h8-9,12H,6-7H2,1-5H3/t8-,9+ |
| InChIKey | NUZXPHIQZUYMOR-DTORHVGONA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C[C@H](C)N[C@H](C)C1 |&1:9,12,r| |
Description and Uses
1-BOC-3,5- dimethylpiperazine is a heterocyclic derivative and can be used as pharmaceutical intermediates.
1-Boc-cis-3,5-dimethyl-piperazine is used in the identification of 7-(3-(Piperazin-1-yl)phenyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine derivatives as highly potent, selective and orally bioavailable PI3Kδ inhibitors.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P264-P271-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P403+P233-P501 |
| Hazard Codes | N |
| Risk Statements | 36/37/38-50 |
| Safety Statements | 26-61 |
| RIDADR | UN3077 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |




![3-Boc-3,8-Diazabicyclo[3.2.1]octane](https://img.chemicalbook.com/CAS/GIF/201162-53-0.gif)

