BD9658155
1-(4-Benzoylphenyl)-1H-pyrrole-2,5-dione , 97% , 92944-71-3
Synonym(s):
Benzophenone-4-maleimide
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB633.60 | In Stock |
|
| 250mg | RMB1076.80 | In Stock |
|
| 1g | RMB2906.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-157°C |
| Boiling point: | 472.9±28.0 °C(Predicted) |
| Density | 1.330±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | chloroform: 50 mg/mL |
| form | Solid |
| pka | -3.80±0.20(Predicted) |
| color | Light Beige |
| InChI | 1S/C17H11NO3/c19-15-10-11-16(20)18(15)14-8-6-13(7-9-14)17(21)12-4-2-1-3-5-12/h1-11H |
| InChIKey | OZIZEXQRIOURIJ-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c2ccc(cc2)C(=O)c3ccccc3 |
Description and Uses
4-(N-Maleimido)benzophenone can be used as a sulfhydryl reactive heterobifunctional photocrosslinking reagent. It generates photoactivatable conjugates from thiols
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
