BD9720555
3-Bromo-3-buten-1-ol , 95% , 76334-36-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB182.40 | In Stock |
|
| 1g | RMB491.20 | In Stock |
|
| 5g | RMB1472.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 64-65 °C9 mm Hg(lit.) |
| Density | 1.522 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | -20°C, stored under nitrogen |
| pka | 14.86±0.10(Predicted) |
| form | liquid (clear) |
| color | clear brown |
| Sensitive | Light Sensitive |
| BRN | 1737671 |
| InChI | InChI=1S/C4H7BrO/c1-4(5)2-3-6/h6H,1-3H2 |
| InChIKey | RTKMFQOHBDVEBC-UHFFFAOYSA-N |
| SMILES | C(O)CC(Br)=C |
Description and Uses
3-Bromo-3-buten-1-ol is useful building block in the synthesis of α-methylene lactones,1 tricyclic sesquiterpenes,2,3 and a number of other cyclization4 and alkylation reactions.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H317-H318 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-41-43 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 29055900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Sens. 1 |





