BD9766555
3-Methylcyclohexanamine , 95% , 6850-35-7
CAS NO.:6850-35-7
Empirical Formula: C7H15N
Molecular Weight: 113.2
MDL number: MFCD00001494
EINECS: 229-940-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB98.40 | In Stock |
|
| 1g | RMB264.00 | In Stock |
|
| 5g | RMB923.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -8.5°C (estimate) |
| Boiling point: | 151°C(lit.) |
| Density | 0.8550 |
| refractive index | 1.4510 to 1.4550 |
| Flash point: | 22 °C |
| storage temp. | 2-8°C, protect from light |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| pka | 10.61±0.70(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C7H15N/c1-6-3-2-4-7(8)5-6/h6-7H,2-5,8H2,1H3 |
| InChIKey | JYDYHSHPBDZRPU-UHFFFAOYSA-N |
| SMILES | C1(N)CCCC(C)C1 |
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H225-H318 |
| Precautionary statements | P210-P233-P240-P241-P242-P243-P280-P303+P361+P353-P370+P378-P403+P235-P501-P280-P305+P351+P338-P310-P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| Hazard Codes | F,C |
| Risk Statements | 10-22-34 |
| RIDADR | UN 2733 3/8/PG II |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| PackingGroup | II |
| HS Code | 2921309990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B |







