A3002112
(-)-10,2-Camphorsultam , ≥98% , 94594-90-8
Synonym(s):
(−)-10,2-Camphorsultam;(−)-exo-10,2-Bornanesultam;(1S,5R)-10,10-Dimethyl-3-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide;[3aS-(3aα,6α,7aβ)]-hexahydro-8,8-dimethyl-3H-3a,6-methano-2,1-benzisothiazole-2,2-dioxide
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB71.20 | In Stock |
|
| 25G | RMB211.20 | In Stock |
|
| 100g | RMB751.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183-185 °C |
| alpha | -33 º (c=4.9, CHCl3) |
| Boiling point: | 324.8±25.0 °C(Predicted) |
| Density | 1.1469 (rough estimate) |
| refractive index | -31 ° (C=1, CHCl3) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethanol, Methanol |
| form | Liquid |
| pka | 11.05±0.40(Predicted) |
| color | Clear colorless |
| optical activity | [α]19/D 32°, c = 5 in chloroform |
| Water Solubility | Slightly soluble in water. |
| BRN | 83811 |
| InChI | 1S/C10H17NO2S/c1-9(2)7-3-4-10(9)6-14(12,13)11-8(10)5-7/h7-8,11H,3-6H2,1-2H3/t7-,8-,10-/m1/s1 |
| InChIKey | DPJYJNYYDJOJNO-NQMVMOMDSA-N |
| SMILES | [H][C@@]12CC[C@]3(CS(=O)(=O)N[C@@H]3C1)C2(C)C |
| CAS DataBase Reference | 94594-90-8(CAS DataBase Reference) |
| NIST Chemistry Reference | (-)-10,2-Camphorsultam(94594-90-8) |
Description and Uses
(1S)-(?)-2,10-Camphorsultam may be used in the asymmetric synthesis of (S)- and (R)-N-Fmoc-S-trityl-α-methylcysteine. It may be used as proton source in the synthesis of chiral α,γ-substituted γ-butyrolactones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |







