A2267812
(1R)-(-)-10-Camphorsulfonyl chloride , 97% , 39262-22-1
Synonym(s):
(−)-Camphor-10-sulfonyl chloride;(1R)-Camphor-10-sulfonic acid chloride
CAS NO.:39262-22-1
Empirical Formula: C10H15ClO3S
Molecular Weight: 250.74
MDL number: MFCD00064155
EINECS: 628-057-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB54.40 | In Stock |
|
| 5G | RMB101.60 | In Stock |
|
| 25G | RMB368.80 | In Stock |
|
| 100G | RMB1254.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-68 °C(lit.) |
| alpha | -33 º (c=3, chloroform) |
| Boiling point: | 349.4±15.0 °C(Predicted) |
| Density | 1.331±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Acetone, Dichloromethane, Ethyl Acetate, Methanol |
| form | Solid |
| color | White |
| optical activity | [α]18/D 33°, c = 3 in chloroform |
| Water Solubility | Decomposes |
| Sensitive | Moisture Sensitive |
| BRN | 3205975 |
| InChI | InChI=1S/C10H15ClO3S/c1-9(2)7-3-4-10(9,8(12)5-7)6-15(11,13)14/h7H,3-6H2,1-2H3/t7-,10-/m0/s1 |
| InChIKey | BGABKEVTHIJBIW-UHFFFAOYSA-N |
| SMILES | [C@@]12(CS(Cl)(=O)=O)C(C)(C)[C@@]([H])(CC1)CC2=O |
| CAS DataBase Reference | 39262-22-1(CAS DataBase Reference) |
Description and Uses
L(-)-10-Camphorsulfonyl chloride is a useful synthetic intermediate,it is used for asymmetric hydroxylation.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29147090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





