BD0782732
(-)-Camphor , 98% , 464-48-2
Synonym(s):
(−)-Camphor;(1S)-1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one
CAS NO.:464-48-2
Empirical Formula: C10H16O
Molecular Weight: 152.23
MDL number: MFCD00064148
EINECS: 207-354-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB48.00 | In Stock |
|
| 5g | RMB190.40 | In Stock |
|
| 25g | RMB758.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177-179 °C(lit.) |
| alpha | -44.8° (20/D)(EtOH) |
| Boiling point: | 204 °C(lit.) |
| Density | 0.990 |
| vapor density | 5.24 (vs air) |
| vapor pressure | 4 mm Hg ( 70 °C) |
| refractive index | -44 ° (C=20, EtOH) |
| Flash point: | 148 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF: 30 mg/ml; DMSO: 20 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS (pH 7.2)(1:2): 0.33 mg/ml |
| form | Adhering Crystals or Crystalline Powder |
| color | White to yellow |
| Specific Gravity | 0.9853 (18℃) |
| Odor | at 10.00 % in dipropylene glycol. camphor |
| Odor Type | camphoreous |
| optical activity | [α]20/D 43°, c = 10 in ethanol |
| explosive limit | 0.6-4.5%(V) |
| Water Solubility | Soluble in water. (0.34 g/L) at 20°C |
| Merck | 14,1732 |
| BRN | 4291747 |
| Stability: | Stable. Incompatible with strong reducing agents, strong oxidizing agents, chlorinated solvents. Protect from direct sunlight. |
| InChI | 1S/C10H16O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3/t7-,10+/m0/s1 |
| InChIKey | DSSYKIVIOFKYAU-OIBJUYFYSA-N |
| SMILES | [H][C@]12CC[C@](C)(C(=O)C1)C2(C)C |
| LogP | 2.089 (est) |
| CAS DataBase Reference | 464-48-2(CAS DataBase Reference) |
| EPA Substance Registry System | l-Camphor (464-48-2) |
Description and Uses
(1S)-(-)-Camphor is used as chiral intermediate and chiral auxiliary precursor. It is used in the synthesis of high-potency sweeteners. It acts as catalytic agent and petrochemical additive.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26 |
| RIDADR | UN 2717 4.1/PG 3 |
| WGK Germany | 1 |
| RTECS | EX1250000 |
| Autoignition Temperature | 870 °F |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29142910 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |






