A2251712
(1R)-(-)-10-Camphorsulfonic acid , 99% , 35963-20-3
Synonym(s):
(±)-Camphor-10-sulfonic acid;(1R)-(?)-Camphor-10-sulfonic acid;(1R)-Camphor-10-sulfonic acid;(1R)-(?)-Camphor-10-sulfonic acid;(1R)-(-)-Camphor-10-sulfonic acid
CAS NO.:35963-20-3
Empirical Formula: C10H16O4S
Molecular Weight: 232.3
MDL number: MFCD00064158
EINECS: 252-817-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB97.60 | In Stock |
|
| 250g | RMB223.20 | In Stock |
|
| 500G | RMB356.80 | In Stock |
|
| 2.5KG | RMB1532.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198 °C (dec.)(lit.) |
| Boiling point: | 344.46°C (rough estimate) |
| alpha | -22 º (c=20,H2O) |
| Density | 1.2981 (rough estimate) |
| refractive index | -21.5 ° (C=5, H2O) |
| storage temp. | Store below +30°C. |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Sparingly) |
| pka | 1.17±0.50(Predicted) |
| form | Crystalline Powder |
| color | White to slightly beige |
| PH | 1.2-1.4 (20g/l, H2O) |
| optical activity | [α]20/D 21°, c = 2 in H2O |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 2809676 |
| Stability: | Stable. Hygroscopic. Incompatible with strong bases, strong oxidizing agents. |
| InChI | 1S/C10H16O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h7H,3-6H2,1-2H3,(H,12,13,14)/t7-,10-/m0/s1 |
| InChIKey | MIOPJNTWMNEORI-XVKPBYJWSA-N |
| SMILES | [H][C@]12CC[C@](CS(O)(=O)=O)(C(=O)C1)C2(C)C |
| CAS DataBase Reference | 35963-20-3(CAS DataBase Reference) |
Description and Uses
(1R)-(-)-Camphor-10-sulfonic acid, is used as a pharamaceutical intermediate and also used as a chiral derivative of Camp. It can also be used as resolving agents for chiral amines and other cations.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-24/25-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






