BD9813547
9H-Pyrido[2,3-b]indol-2-amine , 95+% , 26148-68-5
Synonym(s):
2-Amino-α-carboline;9H-1,9-Diazafluoren-2-amine;9H-Pyrido[2,3-b]indol-2-amine;AαC;AaC
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB2045.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194-196 |
| Boiling point: | 306.89°C (rough estimate) |
| Density | 1.2078 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Methanol (Slightly) |
| pka | 14.87±0.40(Predicted) |
| form | Solid |
| color | Beige to Light Orange |
| InChI | InChI=1S/C11H9N3/c12-10-6-5-8-7-3-1-2-4-9(7)13-11(8)14-10/h1-6H,(H3,12,13,14) |
| InChIKey | FJTNLJLPLJDTRM-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C2=CC=C(N)N=C12 |
| CAS DataBase Reference | 26148-68-5(CAS DataBase Reference) |
| IARC | 2B (Vol. 40, Sup 7) 1987 |
| EPA Substance Registry System | 2-Amino-9H-pyrido[2,3-b]indole (26148-68-5) |
Description and Uses
A pyrolysate that exhibited mutagenic activity toward Salmonella typhimurium TA98 and TA100 from the pyrolytic products of soybean globulin. 2-Amino-9H-pyrido[2,3-b]indole (AαC) and 2-amino-3-methyl-9 H-pyrido[2,3-b]indole (MeAαC) are two mutagenic and carcinogenic heterocyclic amines formed during ordinary cooking.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H340-H351 |
| Precautionary statements | P201-P308+P313 |
| Hazard Codes | Xi |
| RIDADR | 2811 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant/Mutagen |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933998090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 2 Muta. 1B |
| Hazardous Substances Data | 26148-68-5(Hazardous Substances Data) |

![9H-Pyrido[2,3-b]indol-2-amine](https://img.chemicalbook.com/CAS/GIF/26148-68-5.gif)


![3-Amino-9<i>H</i>-pyrido[3,4-<i>b</i>]indole](https://img.chemicalbook.com/CAS/GIF/73834-77-2.gif)