BD9813931
(1S,4R)-Methyl 4-((tert-butoxycarbonyl)amino)cyclopent-2-enecarboxylate , 97% , 168683-02-1
CAS NO.:168683-02-1
Empirical Formula: C12H19NO4
Molecular Weight: 241.28
MDL number: MFCD02259716
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB28.80 | In Stock |
|
| 5g | RMB92.00 | In Stock |
|
| 25g | RMB379.20 | In Stock |
|
| 100g | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 331.2±42.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 11.75±0.40(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C12H19NO4/c1-12(2,3)17-11(15)13-9-6-5-8(7-9)10(14)16-4/h5-6,8-9H,7H2,1-4H3,(H,13,15)/t8-,9+/m1/s1 |
| InChIKey | HKLDTKMTZPXEAZ-BDAKNGLRSA-N |
| SMILES | [C@H]1(C(OC)=O)C[C@@H](NC(OC(C)(C)C)=O)C=C1 |
Description and Uses
4-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-cyclopentene-1-carboxylic acid methyl ester is an intermediate in the synthesis of Peramivir (P285500).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |







