BD0414032
((1S,4R)-4-Aminocyclopent-2-en-1-yl)methanol hydrochloride , 95% , 168960-19-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB37.60 | In Stock |
|
| 5g | RMB104.80 | In Stock |
|
| 10g | RMB174.40 | In Stock |
|
| 25g | RMB317.60 | In Stock |
|
| 100g | RMB1070.40 | In Stock |
|
| 500g | RMB3527.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Inert atmosphere,Room Temperature |
| Appearance | White to off-white Solid |
| InChI | InChI=1/C6H11NO.ClH/c7-6-2-1-5(3-6)4-8;/h1-2,5-6,8H,3-4,7H2;1H/t5-,6+;/s3 |
| InChIKey | DFJSXBUVSKWALM-WSNMCYCBNA-N |
| SMILES | [H]Cl.C([C@H]1C[C@@H](N)C=C1)O |&1:3,5,r| |
Description and Uses
(1S,4R)-4-Amino-2-cyclopentene-1-methanol Hydrochloride is the hydrochloride form of (1S,4R)-4-Amino-2-cyclopentene-1-methanol (A603935) which is an intermediate for the synthesis of Abacavir (A105000), antiviral therapeutic nucleoside analog (1,2,3).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |







