BD9816447
Ethyl3-(2-nitrophenyl)-3-oxopropanoate , 95% , 52119-39-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB355.20 | In Stock |
|
| 1g | RMB573.60 | In Stock |
|
| 5g | RMB1666.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 30-34 °C(lit.) |
| Boiling point: | 170 °C(Press: 0.1 Torr) |
| Density | 1.276±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| pka | 9.42±0.46(Predicted) |
| color | Clear orange to brown |
| InChI | 1S/C11H11NO5/c1-2-17-11(14)7-10(13)8-5-3-4-6-9(8)12(15)16/h3-6H,2,7H2,1H3 |
| InChIKey | OWZNCVIBJQPNEF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccccc1[N+]([O-])=O |
Description and Uses
Ethyl 2-nitrobenzoylacetate may be used to synthesize ethyl 2-bromo-2′-nitrobenzoylacetate and 4-hydroxy-2(1H)-quinolone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |






