![(3AR,6S,6aR)-6-(hydroxymethyl)-2,2-dimethyldihydrofuro[3,4-d][1,3]dioxol-4(3aH)-one](https://img.chemicalbook.com/CAS/GIF/152006-17-2.gif)
BD9818647
(3AR,6S,6aR)-6-(hydroxymethyl)-2,2-dimethyldihydrofuro[3,4-d][1,3]dioxol-4(3aH)-one , 95+% , 152006-17-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB3361.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-97°C |
| Boiling point: | 338.1±37.0 °C(Predicted) |
| Density | 1.258±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Acetone (Sparingly), Chloroform (Slightly) |
| form | Solid |
| pka | 13.68±0.10(Predicted) |
| color | White to Pale Beige |
| InChI | InChI=1/C8H12O5/c1-8(2)12-5-4(3-9)11-7(10)6(5)13-8/h4-6,9H,3H2,1-2H3/t4-,5+,6+/s3 |
| InChIKey | NHHKFJCWLPPNCN-FLEGHBDQNA-N |
| SMILES | [C@]12([H])OC(C)(C)O[C@@]1([H])C(O[C@H]2CO)=O |&1:0,7,11,r| |
Description and Uses
2,3-O-(1-Methylethylidene)-L-lyxonic acid γ-lactone is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1].
