BD9826755
Ammoniumtetraphenylborate , 98% , 14637-34-4
Synonym(s):
Tetraphenylboron ammonium
| Pack Size | Price | Stock | Quantity |
| 1g | RMB54.40 | In Stock |
|
| 5g | RMB188.80 | In Stock |
|
| 25g | RMB640.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220 °C (dec.)(lit.) |
| storage temp. | Store at room temperature, keep dry and cool |
| Appearance | White to off-white Solid |
| BRN | 3799683 |
| InChI | InChI=1S/C24H20B.H3N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h1-20H;1H3/q-1;/p+1 |
| InChIKey | ZWFYDLYRTYMBIL-UHFFFAOYSA-O |
| SMILES | [B-](C1C=CC=CC=1)(C1C=CC=CC=1)(C1=CC=CC=C1)C1C=CC=CC=1.[NH4+] |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-9 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
