BD9835147
(S)-tert-Butyl(1-cyanopropan-2-yl)carbamate , 95% , 172695-22-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB190.40 | In Stock |
|
| 250mg | RMB323.20 | In Stock |
|
| 1g | RMB871.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-71 °C(Solv: dichloromethane (75-09-2)) |
| Boiling point: | 309.5±25.0 °C(Predicted) |
| Density | 1.005±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 11.72±0.46(Predicted) |
| InChI | InChI=1S/C9H16N2O2/c1-7(5-6-10)11-8(12)13-9(2,3)4/h7H,5H2,1-4H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | DIUMTAGYVCAZRM-ZETCQYMHSA-N |
| SMILES | C(OC(C)(C)C)(=O)N[C@@H](C)CC#N |
Description and Uses
(S)-tert-Butyl (1-Cyanopropan-2-yl)carbamate is an intermediate used to synthesize spermidine analogs of 15-deoxyspergualin with immunosuppressive activities.
