BD9856655
tert-Butyl(3-bromophenyl)carbamate , 98% , 25216-74-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB94.40 | In Stock |
|
| 5g | RMB142.40 | In Stock |
|
| 25g | RMB425.60 | In Stock |
|
| 100g | RMB1134.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-89 °C(lit.) |
| Boiling point: | 279.6±23.0 °C(Predicted) |
| Density | 1.398±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | 13.19±0.70(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C11H14BrNO2/c1-11(2,3)15-10(14)13-9-6-4-5-8(12)7-9/h4-7H,1-3H3,(H,13,14) |
| InChIKey | VDFBCTSISJDKNW-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NC1=CC=CC(Br)=C1 |
Description and Uses
N-(tert-Butoxycarbonyl)-3-bromoaniline [tert-butyl N-(3-bromophenyl)carbamate] is a protected amine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






