BD9864555
Ethyl2-chloro-4,4,4-trifluoro-3-oxobutanoate , 98%GC , 363-58-6
CAS NO.：363-58-6
Empirical Formula: C6H6ClF3O3
Molecular Weight: 218.56
MDL number: MFCD00041540
EINECS: 670-525-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB70.40 | In Stock |
|
| 5g | RMB212.80 | In Stock |
|
| 25g | RMB686.40 | In Stock |
|
| 100g | RMB2448.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 67 °C |
| Density | 1.39 |
| refractive index | 1.388 |
| Flash point: | 28 |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| pka | 4.96±0.35(Predicted) |
| form | liquid |
| color | Clear, colourless |
| BRN | 1787023 |
| InChI | InChI=1S/C6H6ClF3O3/c1-2-13-5(12)3(7)4(11)6(8,9)10/h3H,2H2,1H3 |
| InChIKey | YVWUNJVPOCYLIM-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Cl)C(=O)C(F)(F)F |
| CAS DataBase Reference | 363-58-6(CAS DataBase Reference) |
Description and Uses
Ethyl 2-Chloro-4,4,4-trifluoroacetoacetate is used in preparation of furoindazole derivatives as GPR84 antagonists useful in treating diseasess.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H227-H314-H318 |
| Precautionary statements | P210e-P260h-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | F,Xi |
| Risk Statements | 34-36 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3265 |
| Hazard Note | Flammable/Harmful |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2918300090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
