PRODUCT Properties
| Melting point: | 25°C |
| Boiling point: | 163-164 °C (lit.) |
| Density | 1.713 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 179 °F |
| storage temp. | 2-8°C |
| pka | 4.09±0.33(Predicted) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Almost white or Almost colorless |
| InChI | 1S/C7HF7O/c8-2-1(7(12,13)14)3(9)5(11)6(15)4(2)10/h15H |
| InChIKey | HZQGKHUTYHEFBT-UHFFFAOYSA-N |
| SMILES | Oc1c(F)c(F)c(c(F)c1F)C(F)(F)F |
| CAS DataBase Reference | 2787-79-3(CAS DataBase Reference) |
Description and Uses
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)phenol (Perfluoro-p-cresol), an organofluorine compound, is an aryl fluorinated building block. It is a colorless liquid having hygroscopic properties and a faintly phenolic odor. It has been prepared by using octafluorotoluene as starting reagent. Various physical properties (density, refractive index, freezing point and boiling point) of 2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenol have been reported.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HS Code | 29081990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
