PRODUCT Properties
| Melting point: | 77-79°C |
| Boiling point: | 437.4±38.0 °C(Predicted) |
| Density | 1.18 |
| storage temp. | 2-8°C |
| pka | 6.90±0.35(Predicted) |
| form | liquid |
| color | clearoily |
| Water Solubility | Insoluble in water. |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C17H14O4/c1-11(2)17(20)21-13-8-9-14(15(18)10-13)16(19)12-6-4-3-5-7-12/h3-10,18H,1H2,2H3 |
| InChIKey | IMNBHNRXUAJVQE-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1)(C1C=CC(=CC=1O)OC(=O)C(=C)C)=O |
| CAS DataBase Reference | 2035-72-5(CAS DataBase Reference) |
Description and Uses
4-Methacryloxy-2-hydroxybenzophenone is a UV absorber that can be used in ophthamic and optical applications.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37 |
| HS Code | 29145090 |
