BD9904755
2-Methyl-1-(pyrimidin-5-yl)-1-(4-(trifluoromethoxy)phenyl)propan-1-ol , 98% , 56425-91-3
Synonym(s):
α-(1-Methylethyl)-α-[4-(trifluoromethoxy)phenyl]-5-pyrimidinemethanol
CAS NO.:56425-91-3
Empirical Formula: C15H15F3N2O2
Molecular Weight: 312.29
MDL number: MFCD00072512
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB348.80 | In Stock |
|
| 250mg | RMB592.80 | In Stock |
|
| 1g | RMB1600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-96° |
| Boiling point: | 264°C (rough estimate) |
| Density | 1.2779 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 12.23±0.29(Predicted) |
| color | White to Off-White |
| BRN | 892930 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C15H15F3N2O2/c1-10(2)14(21,12-7-19-9-20-8-12)11-3-5-13(6-4-11)22-15(16,17)18/h3-10,21H,1-2H3 |
| InChIKey | VEVZCONIUDBCDC-UHFFFAOYSA-N |
| SMILES | C(C1=CN=CN=C1)(C1=CC=C(OC(F)(F)F)C=C1)(O)C(C)C |
| LogP | 3.340 |
| EPA Substance Registry System | Flurprimidol (56425-91-3) |
Description and Uses
Growth retardant for grasses.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H411 |
| Precautionary statements | P264-P270-P273-P301+P312-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36-38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 |
| Toxicity | LD50 dermally in rabbits: >2000 mg/kg (Thompson) |





