BD9915331
(1S,2S)-Cyclohexane-1,2-diyldimethanol , 97% , 3205-34-3
CAS NO.:3205-34-3
Empirical Formula: C8H16O2
Molecular Weight: 144.21
MDL number: MFCD22572336
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB120.00 | In Stock |
|
| 1g | RMB284.00 | In Stock |
|
| 5g | RMB986.40 | In Stock |
|
| 25g | RMB3620.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-63℃ |
| Boiling point: | 270℃ |
| Density | 1.004 |
| Flash point: | 129℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.75±0.10(Predicted) |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H16O2/c9-5-7-3-1-2-4-8(7)6-10/h7-10H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | XDODWINGEHBYRT-HTQZYQBOSA-N |
| SMILES | [C@H]1(CO)CCCC[C@@H]1CO |
Description and Uses
(1S,?2S)?-1,?2-?Cyclohexanedimethano?l is an intermediate used to synthesize C2-?symmetrical diphosphines using chiral zinc organometallics.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |




![4-(1,2-Benzothiazol-3-yl)-1-[(3aR,7aR)-octahydro-2H-isoindol-2-yl]piperazin-1-ium-1-sulfonate](https://img.chemicalbook.com/CAS/20180906/GIF/186204-37-5.gif)
![(3aR,4S,7R,7aS)-2-(((1S,2S)-2-((4-(benzo[d]isothiazol-3-yl)piperazin-1-yl)methyl)cyclohexyl)methyl)hexahydro-1H-4,7-methanoisoindole-1,3(2H)-dione](https://img.chemicalbook.com/CAS/20180703/GIF/CB93954895.gif)

