BD9925755
1-(Bicyclo[2.2.1]hept-5-en-2-yl)ethanone , 98% , 5063-03-6
Synonym(s):
Methyl 5-norbornen-2-yl ketone
CAS NO.:5063-03-6
Empirical Formula: C9H12O
Molecular Weight: 136.19
MDL number: MFCD00167570
EINECS: 225-767-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB236.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 84-86 °C18 mm Hg(lit.) |
| Density | 1.005 g/mL at 25 °C(lit.) |
| vapor pressure | 45.33Pa at 25℃ |
| refractive index | n |
| Flash point: | 143 °F |
| storage temp. | 4°C |
| solubility | Chloroform, Methanol (Slightly) |
| form | Liquid |
| Specific Gravity | 1.005 |
| color | Clear light yellow to yellow-brown |
| InChI | 1S/C9H12O/c1-6(10)9-5-7-2-3-8(9)4-7/h2-3,7-9H,4-5H2,1H3/t7-,8+,9?/m1/s1 |
| InChIKey | NIMLCWCLVJRPFY-WGTSGOJVSA-N |
| SMILES | CC(=O)C1C[C@H]2C[C@@H]1C=C2 |
| LogP | 2.05 |
| CAS DataBase Reference | 5063-03-6(CAS DataBase Reference) |
Description and Uses
5-Acetyl-2-norbornene is an intermediate used in the synthesis of the 2-acetylnorbornyl isothiocyanates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P370+P378-P403+P235-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 24/25-37-26 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29142990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |

![1-(Bicyclo[2.2.1]hept-5-en-2-yl)ethanone](https://img.chemicalbook.com/CAS/GIF/5063-03-6.gif)



![exo-2-Acetylbicyclo[2.2.1]hept-5-ene](https://img.chemicalbook.com/CAS/GIF/824-61-3.gif)