BD9936155
(Z)-3-Hydroxypropane-1,2-diyldioleate , 99%mixtureofIsomers , 2442-61-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB72.80 | In Stock |
|
| 100g | RMB240.00 | In Stock |
|
| 500g | RMB840.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 670.8±35.0 °C(Predicted) |
| Density | 0.9218 g/cm3 |
| Flash point: | 17 °C |
| storage temp. | −20°C |
| solubility | DMF: 10 mg/ml; Ethanol: 10 mg/ml; Ethanol:PBS(pH 7.2) (1:1): .5 mg/ml |
| pka | 13.69±0.10(Predicted) |
| form | Colorless oil or waxy solid. |
| biological source | synthetic (organic) |
| BRN | 1917687 |
| Stability: | Light sensitive, Volatile |
| InChIKey | AFSHUZFNMVJNKX-CLFAGFIQSA-N |
| SMILES | C(OC(=O)CCCCCCC/C=C\CCCCCCCC)(CO)COC(=O)CCCCCCC/C=C\CCCCCCCC |
Description and Uses
1,2-Dioleoyl-rac-glycerol is an analog of 1,3-Dioleoylglycerol (D484210) which is used in the synthesis of amphiphilic gadolinium complexes as MRI contrast agents.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319-H336 |
| Precautionary statements | P210-P240-P241-P242-P243-P261-P264-P271-P280-P303+P361+P353-P304+P340-P305+P351+P338-P312-P337+P313-P370+P378-P403+P233-P403+P235-P405-P501 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-20/21/22 |
| Safety Statements | 36/37 |
| RIDADR | UN 1282 3/PG 2 |
| WGK Germany | 3 |
| F | 10 |






![TRIOLEIN, [9,10-3H(N)]](https://img.chemicalbook.com/CAS/GIF/70805-83-3.gif)