BD9949255
Hexadecylmethacrylate , 98%+(stabilizedwithMEHQ) , 2495-27-4
CAS NO.：2495-27-4
Empirical Formula: C20H38O2
Molecular Weight: 310.51
MDL number: MFCD00078346
EINECS: 219-672-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB67.20 | In Stock |
|
| 5g | RMB208.00 | In Stock |
|
| 25g | RMB665.60 | In Stock |
|
| 100g | RMB1928.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 15°C |
| Boiling point: | 390.66°C (rough estimate) |
| Density | 0.9849 (rough estimate) |
| vapor pressure | 0.06Pa at 20℃ |
| refractive index | 1.4498 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Clear Colorless |
| InChI | InChI=1S/C20H38O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-20(21)19(2)3/h2,4-18H2,1,3H3 |
| InChIKey | ZNAOFAIBVOMLPV-UHFFFAOYSA-N |
| SMILES | C(OCCCCCCCCCCCCCCCC)(=O)C(C)=C |
| LogP | 8.64 at 20℃ |
| EPA Substance Registry System | Hexadecyl methacrylate (2495-27-4) |
Description and Uses
Hexadecyl Methacrylate is a reagent in the synthesis of methacrylate copolymers and terpolymers which are used as lubricating oil pour point depressants.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN3082 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| Hazardous Substances Data | 2495-27-4(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
