M7452658
WithanolideA , ≥98% , 32911-62-9
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1912.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 305℃ (DEC.) |
| Boiling point: | 651.6±55.0 °C(Predicted) |
| Density | 1.264 |
| storage temp. | -20°C |
| solubility | methanol: soluble1mg/mL, clear, colorless |
| form | powder |
| pka | 13.05±0.70(Predicted) |
| color | white |
| Major Application | food and beverages |
| InChIKey | DXWHOKCXBGLTMQ-OCNHUHSRNA-N |
| SMILES | CC1=C(C)C(=O)O[C@H](C1)[C@](C)(O)[C@H]2CC[C@H]3[C@H]4[C@H](CC[C@]23C)[C@@]5(C)C(=O)C=CC[C@]5(O)[C@H]6O[C@@H]46 |
Description and Uses
Withanolide A, is a neuritogenic steroid. It may act as deterrent for feeding insect larva and other herbivores. Withaferin A, causes activation of Notch2 and Notch4 in human breast cancer cells, and thus used as novel anticancer agents.
Safety
| WGK Germany | 3 |
| HS Code | 2932206000 |
| Storage Class | 11 - Combustible Solids |





