BD9951431
4-Chlorobenzo[b]thiophene-2-carboxylic acid , 90% , 23967-57-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB20.00 | In Stock |
|
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB96.00 | In Stock |
|
| 10g | RMB175.20 | In Stock |
|
| 25g | RMB426.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-223 |
| Boiling point: | 408.6±25.0 °C(Predicted) |
| Density | 1.546±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| pka | 3.28±0.30(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| InChI | InChI=1S/C9H5ClO2S/c10-6-2-1-3-7-5(6)4-8(13-7)9(11)12/h1-4H,(H,11,12) |
| InChIKey | IPAXPERGAMNMIJ-UHFFFAOYSA-N |
| SMILES | C12=CC=CC(Cl)=C1C=C(C(O)=O)S2 |
Description and Uses
4-Chlorobenzo[b]thiophene-2-carboxylic Acid is an intermediate used to prepare histone deacetylase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |

![4-Chlorobenzo[b]thiophene-2-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/23967-57-9.gif)

![3,4-Dichlorobenzo[b]thiophene-2-carboxylicacid](https://img.chemicalbook.com/StructureFile/ChemBookStructure3/GIF/CB0313834.gif)
![Ethyl3-amino-4-chlorobenzo[b]thiophene-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/67189-92-8.gif)

![Methyl4-chlorobenzo[b]thiophene-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/35212-95-4.gif)